3-bromo-2-phenyl-1H-quinolin-4-one structure
|
Common Name | 3-bromo-2-phenyl-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 6639-96-9 | Molecular Weight | 300.15000 | |
| Density | 1.526g/cm3 | Boiling Point | 403.1ºC at 760 mmHg | |
| Molecular Formula | C15H10BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | 3-bromo-2-phenyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760 mmHg |
| Molecular Formula | C15H10BrNO |
| Molecular Weight | 300.15000 |
| Flash Point | 197.6ºC |
| Exact Mass | 298.99500 |
| PSA | 33.12000 |
| LogP | 4.36990 |
| Index of Refraction | 1.673 |
| InChIKey | XTXHUFVPTJDODX-UHFFFAOYSA-N |
| SMILES | O=c1c(Br)c(-c2ccccc2)[nH]c2ccccc12 |
|
~%
3-bromo-2-pheny... CAS#:6639-96-9 |
| Literature: Kaslow; Lawton Journal of the American Chemical Society, 1950 , vol. 72, p. 1729 |
|
~%
3-bromo-2-pheny... CAS#:6639-96-9 |
| Literature: Kaslow; Nix Proceedings of the Indiana Academy of Science, 1952 , vol. 61, p. 121,122 |
| 3-bromo-2-phenylquinolin-4(1h)-one |
| 3-Brom-2-phenyl-chinolin-4-ol |
| 3-bromo-2-phenyl-quinolin-4-ol |