2,4-diaminofluoren-9-one
Modify Date: 2025-08-25 13:57:25
2,4-diaminofluoren-9-one structure
|
Common Name | 2,4-diaminofluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 6638-62-6 | Molecular Weight | 210.23100 | |
| Density | 1.407g/cm3 | Boiling Point | 528.2ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2ºC | |
| Name | 2,4-diaminofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 528.2ºC at 760 mmHg |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 273.2ºC |
| Exact Mass | 210.07900 |
| PSA | 69.11000 |
| LogP | 3.22480 |
| Index of Refraction | 1.775 |
| InChIKey | WMNBHWWCHOVGHV-UHFFFAOYSA-N |
| SMILES | Nc1cc(N)c2c(c1)C(=O)c1ccccc1-2 |
|
~%
2,4-diaminofluo... CAS#:6638-62-6 |
| Literature: Fletcher et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 1092 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-diamino-fluoren-9-one |
| 2,4-diamino-9h-fluoren-9-one |
| HMS3089I05 |
| 2.4-Diamino-fluorenon-(9) |