2,3-diaminofluoren-9-one structure
|
Common Name | 2,3-diaminofluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 6633-42-7 | Molecular Weight | 210.23100 | |
| Density | 1.407g/cm3 | Boiling Point | 497.4ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.6ºC | |
| Name | 2,3-diaminofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 497.4ºC at 760 mmHg |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 254.6ºC |
| Exact Mass | 210.07900 |
| PSA | 69.11000 |
| LogP | 3.22480 |
| Index of Refraction | 1.775 |
| InChIKey | MSURJSLHFVCZLX-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1N)-c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
2,3-diaminofluo... CAS#:6633-42-7 |
| Literature: Eckert; Langecker Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2> 118, p. 269 |
|
~%
2,3-diaminofluo... CAS#:6633-42-7 |
| Literature: Eckert; Langecker Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2> 118, p. 269 |
|
~%
2,3-diaminofluo... CAS#:6633-42-7 |
| Literature: Eckert; Langecker Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2> 118, p. 269 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-diamino-fluoren-9-one |
| 2,3-diamino-9h-fluoren-9-one |