1H-Pyrrole-2,5-dione,1-(4-fluorophenyl)- structure
|
Common Name | 1H-Pyrrole-2,5-dione,1-(4-fluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6633-22-3 | Molecular Weight | 191.15900 | |
| Density | 1.421g/cm3 | Boiling Point | 317.8ºC at 760 mmHg | |
| Molecular Formula | C10H6FNO2 | Melting Point | 156°C | |
| MSDS | N/A | Flash Point | 146ºC | |
| Name | 1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 317.8ºC at 760 mmHg |
| Melting Point | 156°C |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.15900 |
| Flash Point | 146ºC |
| Exact Mass | 191.03800 |
| PSA | 37.38000 |
| LogP | 1.32010 |
| Index of Refraction | 1.605 |
| InChIKey | SBKKXWSZVVDOLR-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(F)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
|
~%
1H-Pyrrole-2,5-... CAS#:6633-22-3 |
| Literature: Synthesis, , # 10 p. 1549 - 1552 |
|
~%
1H-Pyrrole-2,5-... CAS#:6633-22-3 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1147 - 1152 |
|
~74%
1H-Pyrrole-2,5-... CAS#:6633-22-3 |
| Literature: Zhu, ShiZeng; Xu, Bin; Zhang, Jie Journal of Fluorine Chemistry, 1995 , vol. 74, # 2 p. 203 - 206 |
|
~%
1H-Pyrrole-2,5-... CAS#:6633-22-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 9 p. 2823 - 2834 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-fluorophenyl)pyrrole-2,5-dione |