N-[(4-chlorophenyl)sulfanylmethyl]-N-methyl-4-nitro-aniline structure
|
Common Name | N-[(4-chlorophenyl)sulfanylmethyl]-N-methyl-4-nitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 6631-98-7 | Molecular Weight | 308.78300 | |
| Density | 1.36g/cm3 | Boiling Point | 463.4ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.1ºC | |
| Name | [(3R,3aS,3bS,5aS,6R,8aS,8bR,10aS)-2,6-diethynyl-3a,5a-dimethyl-6-propanoyloxy-2,3,3b,4,5,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[4,5-g]inden-3-yl] propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 463.4ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.78300 |
| Flash Point | 234.1ºC |
| Exact Mass | 308.03900 |
| PSA | 74.36000 |
| LogP | 4.95740 |
| Index of Refraction | 1.659 |
| InChIKey | FZCSLTAOTLNGHI-UHFFFAOYSA-N |
| SMILES | CN(CSc1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
N-[(4-chlorophe... CAS#:6631-98-7 |
| Literature: Grillot; Schaffrath Journal of Organic Chemistry, 1959 , vol. 24, p. 1035,1036 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-p-Nitrophenylaminomethyl-p-chlorophenyl sulfide |