2-[[(4-iodophenyl)amino]methyl]isoindole-1,3-dione structure
|
Common Name | 2-[[(4-iodophenyl)amino]methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6629-41-0 | Molecular Weight | 378.16500 | |
| Density | 1.804g/cm3 | Boiling Point | 503.7ºC at 760 mmHg | |
| Molecular Formula | C15H11IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | 2-[(4-iodoanilino)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.804g/cm3 |
|---|---|
| Boiling Point | 503.7ºC at 760 mmHg |
| Molecular Formula | C15H11IN2O2 |
| Molecular Weight | 378.16500 |
| Flash Point | 258.4ºC |
| Exact Mass | 377.98700 |
| PSA | 49.41000 |
| LogP | 2.96770 |
| Index of Refraction | 1.738 |
| InChIKey | QYOMCIMBWLKWKQ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CNc1ccc(I)cc1 |
|
~%
2-[[(4-iodophen... CAS#:6629-41-0 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms1608i01 |