2-[[(4-ethoxyphenyl)amino]methyl]isoindole-1,3-dione
Modify Date: 2025-09-22 18:44:57
![2-[[(4-ethoxyphenyl)amino]methyl]isoindole-1,3-dione Structure](https://image.chemsrc.com/caspic/098/7506-36-7.png)
2-[[(4-ethoxyphenyl)amino]methyl]isoindole-1,3-dione structure
|
Common Name | 2-[[(4-ethoxyphenyl)amino]methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 7506-36-7 | Molecular Weight | 296.32100 | |
| Density | 1.299g/cm3 | Boiling Point | 492ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4ºC | |
| Name | 2-[(4-ethoxyanilino)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 492ºC at 760 mmHg |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.32100 |
| Flash Point | 251.4ºC |
| Exact Mass | 296.11600 |
| PSA | 58.64000 |
| LogP | 2.76180 |
| Index of Refraction | 1.646 |
| InChIKey | UFTIHDWDIDPBGV-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NCN2C(=O)c3ccccc3C2=O)cc1 |
| HS Code | 2925190090 |
|---|
|
~%
2-[[(4-ethoxyph... CAS#:7506-36-7 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Phthalimidomethyl-4-ethoxyanilin |
| HMS561H15 |
| N-p-phenetidinomethyl-phthalimide |