Sancycline Hydrochloride structure
|
Common Name | Sancycline Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 6625-20-3 | Molecular Weight | 450.87 | |
| Density | 1.61g/cm3 | Boiling Point | 639.9ºC at 760 mmHg | |
| Molecular Formula | C21H23ClN2O7 | Melting Point | 224-228° C (dec.) | |
| MSDS | N/A | Flash Point | 340.8ºC | |
Use of Sancycline HydrochlorideSancycline (Bonomycin; 6-Demethyl-6-deoxytetracycline) hydrochloride is a semi-synthetic tetracycline antibiotic[1]. |
| Name | Sancycline Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Sancycline (Bonomycin; 6-Demethyl-6-deoxytetracycline) hydrochloride is a semi-synthetic tetracycline antibiotic[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 639.9ºC at 760 mmHg |
| Melting Point | 224-228° C (dec.) |
| Molecular Formula | C21H23ClN2O7 |
| Molecular Weight | 450.87 |
| Flash Point | 340.8ºC |
| Exact Mass | 450.11900 |
| PSA | 161.39000 |
| LogP | 1.62290 |
| Index of Refraction | 1.734 |
| InChIKey | CIJFGLCHAOVWRZ-QKYUADJBSA-N |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4CC3CC12.Cl |
| Storage condition | 2-8℃ |
| 2-Naphthacenecarboxamide, 4-dimethylamino-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-, hydrochloride |