2-(3,4-dimethoxyphenyl)-1-(2,4,5-trihydroxyphenyl)ethanone
Modify Date: 2025-11-25 12:43:25
2-(3,4-dimethoxyphenyl)-1-(2,4,5-trihydroxyphenyl)ethanone structure
|
Common Name | 2-(3,4-dimethoxyphenyl)-1-(2,4,5-trihydroxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 66116-74-3 | Molecular Weight | 304.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,4-dimethoxyphenyl)-1-(2,4,5-trihydroxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O6 |
|---|---|
| Molecular Weight | 304.29500 |
| Exact Mass | 304.09500 |
| PSA | 96.22000 |
| LogP | 2.24600 |
| InChIKey | XENYBVPCIRWTMR-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)c2cc(O)c(O)cc2O)cc1OC |
|
~%
2-(3,4-dimethox... CAS#:66116-74-3 |
| Literature: Anjaneyulu; Rajagopalan Proceedings - Indian Academy of Sciences, Section A, 1959 , # 50 p. 219,222 |
|
~%
2-(3,4-dimethox... CAS#:66116-74-3 |
| Literature: Jain, Amolak C.; Prasad, Ashok K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 622 - 624 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethanone,2-(3,4-dimethoxyphenyl)-1-(2,4,5-trihydroxyphenyl) |
| 2,4,5-Trihydroxy-3',4'-dimethoxy-desoxybenzoin |
| 2,4,5-trihydroxy-3',4'-dimethoxy-deoxybenzoin |
| 1-(2,4,5-trihydroxyphenyl)-2-(3,4-dimethoxyphenyl)ethanone |
| 3,4-dimethoxybenzyl 2,4,5-trihydroxyphenyl ketone |