2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate structure
|
Common Name | 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate | ||
|---|---|---|---|---|
| CAS Number | 65907-30-4 | Molecular Weight | 382.47400 | |
| Density | 1.208g/cm3 | Boiling Point | 460ºC | |
| Molecular Formula | C18H26N2O5S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | furathiocarb |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 460ºC |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.47400 |
| Exact Mass | 382.15600 |
| PSA | 93.61000 |
| LogP | 4.26240 |
| Index of Refraction | 1.551 |
| InChIKey | HAWJXYBZNNRMNO-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)N(C)SN(C)C(=O)Oc1cccc2c1OC(C)(C)C2 |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H317-H319-H330-H334-H373-H410 |
| Precautionary Statements | P260-P273-P280-P284-P301 + P310 + P330-P304 + P340 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+;N |
| Risk Phrases | R25;R26;R36/38;R43;R48/22;R50/53 |
| Safety Phrases | S28;S38;S45;S60;S61;S36/S37 |
| RIDADR | UN 2811 |
| RTECS | DF6652100 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
|
Dermal pharmacokinetics of the insecticide furathiocarb in rats.
Pest Manag. Sci. 58(1) , 57-62, (2002) The pharmacokinetics of furathiocarb were studied in vivo in male Sprague-Dawley rats following dermal treatment. HPLC and post-column derivatization were used for the analysis of furathiocarb and its... |
|
|
[Sensitivity of taiga mites to dilor, etafos, izophen, omait and deltanit].
Med. Parazitol. (Mosk.) (1) , 37-40, (1987)
|
|
|
Allergic reaction induced by dermal and/or respiratory exposure to low-dose phenoxyacetic acid, organophosphorus, and carbamate pesticides.
Toxicology 261(3) , 152-61, (2009) Several types of pesticides, such as organophosphates, phenoxyacetic acid, and carbamate have a high risk of affecting human health, causing allergic rhinitis and bronchial asthma-like diseases. We us... |
| Deltanit |
| 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl 2,4-dimethyl-5-oxo-6-oxa-3-thia-2,4-diazadecan-1-oate |
| Promet 660SCO |
| Promet |
| Furathiocarb [BSI:ISO] |
| Deltanet |
| MFCD00078698 |
| 2,3-dihydro-2,2-dimethyl-7-benzofuranyl 2,4-dimethyl-5-oxo-6-oxa-3-thia-2,4-diazadecanoate |
| butyl 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N,N'-dimethyl-N,N'-thiodicarbamate |
| butyl 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N,N’-dimethyl-N,N’-thiodicarbamate |
| EINECS 265-974-3 |
| (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[butoxycarbonyl(methyl)amino]sulfanyl-N-methylcarbamate |