2-(oxan-2-yloxy)isoindole-1,3-dione structure
|
Common Name | 2-(oxan-2-yloxy)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6584-60-7 | Molecular Weight | 247.24700 | |
| Density | 1.36g/cm3 | Boiling Point | 398.3ºC at 760 mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.7ºC | |
| Name | 2-(oxan-2-yloxy)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 398.3ºC at 760 mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.24700 |
| Flash Point | 194.7ºC |
| Exact Mass | 247.08400 |
| PSA | 55.84000 |
| LogP | 1.67870 |
| Index of Refraction | 1.609 |
| InChIKey | HCTSKKKGJQTHDG-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1OC1CCCCO1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| tetrahydropyranyl ether of N-hydroxyphthalimide |
| O-tetrahydropyranylhydroxyphthalimide |
| N-tetrahydropyran-2-yloxy-phthalimide |
| N-tetrahydropyranyloxyphthalimide |