Benzoic acid,2-[[(5-chloro-2-hydroxyphenyl)methylene]amino]-, methyl ester structure
|
Common Name | Benzoic acid,2-[[(5-chloro-2-hydroxyphenyl)methylene]amino]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 65553-39-1 | Molecular Weight | 289.71400 | |
| Density | 1.33g/cm3 | Boiling Point | 403.3ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | methyl 2-[[(E)-(3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]benzoate |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 403.3ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.71400 |
| Flash Point | 197.7ºC |
| Exact Mass | 289.05100 |
| PSA | 58.89000 |
| LogP | 3.58280 |
| Index of Refraction | 1.616 |
| InChIKey | URJYPMDUSRVBJY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1N=Cc1cc(Cl)ccc1O |
|
~66%
Benzoic acid,2-... CAS#:65553-39-1 |
| Literature: Sengupta, Dibyendu; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 923 - 927 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |