2-[2-[(4-chlorobenzoyl)amino]-5-methoxyphenoxy]acetic acid
Modify Date: 2025-09-09 19:34:58
![2-[2-[(4-chlorobenzoyl)amino]-5-methoxyphenoxy]acetic acid Structure](https://image.chemsrc.com/caspic/411/6548-55-6.png)
2-[2-[(4-chlorobenzoyl)amino]-5-methoxyphenoxy]acetic acid structure
|
Common Name | 2-[2-[(4-chlorobenzoyl)amino]-5-methoxyphenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6548-55-6 | Molecular Weight | 335.73900 | |
| Density | 1.402g/cm3 | Boiling Point | 458.8ºC at 760 mmHg | |
| Molecular Formula | C16H14ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.3ºC | |
| Name | 2-[2-[(4-chlorobenzoyl)amino]-5-methoxyphenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 458.8ºC at 760 mmHg |
| Molecular Formula | C16H14ClNO5 |
| Molecular Weight | 335.73900 |
| Flash Point | 231.3ºC |
| Exact Mass | 335.05600 |
| PSA | 84.86000 |
| LogP | 3.13730 |
| Index of Refraction | 1.63 |
| InChIKey | YFVPMPQQUFKWEL-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)cc2)c(OCC(=O)O)c1 |
|
~%
2-[2-[(4-chloro... CAS#:6548-55-6 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |
![7-Methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one structure](https://image.chemsrc.com/caspic/405/6529-94-8.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-((4-Chlorobenzoyl)amino)-5-methoxyphenoxy)acetic acid |
| Acetic acid,(2-(p-chlorobenzamide)-5-methoxyphenoxy) |
| Acetic acid,(2-((4-chlorobenzoyl)amino)-5-methoxyphenoxy) |