2-[2-[(3,4-dichlorobenzoyl)amino]-4-methylphenoxy]acetic acid
Modify Date: 2025-09-06 10:47:58
![2-[2-[(3,4-dichlorobenzoyl)amino]-4-methylphenoxy]acetic acid Structure](https://image.chemsrc.com/caspic/449/6548-54-5.png)
2-[2-[(3,4-dichlorobenzoyl)amino]-4-methylphenoxy]acetic acid structure
|
Common Name | 2-[2-[(3,4-dichlorobenzoyl)amino]-4-methylphenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6548-54-5 | Molecular Weight | 354.18500 | |
| Density | 1.453g/cm3 | Boiling Point | 470ºC at 760 mmHg | |
| Molecular Formula | C16H13Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238ºC | |
| Name | 2-[2-[(3,4-dichlorobenzoyl)amino]-4-methylphenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 470ºC at 760 mmHg |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.18500 |
| Flash Point | 238ºC |
| Exact Mass | 353.02200 |
| PSA | 79.12000 |
| LogP | 4.40150 |
| Index of Refraction | 1.645 |
| InChIKey | AJQVJNRWYSKGQO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCC(=O)O)c(NC(=O)c2ccc(Cl)c(Cl)c2)c1 |
|
~%
2-[2-[(3,4-dich... CAS#:6548-54-5 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ACETIC ACID,((2-(3,4-DICHLOROBENZAMIDO)-p-TOLYL)OXY) |
| ((2-(3,4-Dichlorobenzamido)-p-tolyl)oxy)acetic acid |