potassium,1,2-bis(ethenyl)benzene,2-methylprop-2-enoate structure
|
Common Name | potassium,1,2-bis(ethenyl)benzene,2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 65405-55-2 | Molecular Weight | 254.36600 | |
| Density | N/A | Boiling Point | 207.3ºC at 760 mmHg | |
| Molecular Formula | C14H15KO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | potassium,1,2-bis(ethenyl)benzene,2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 207.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H15KO2 |
| Molecular Weight | 254.36600 |
| Flash Point | 71.9ºC |
| Exact Mass | 254.07100 |
| PSA | 40.13000 |
| LogP | 2.28500 |
| InChIKey | WVWZXTJUCNEUAE-UHFFFAOYSA-M |
| SMILES | C=C(C)C(=O)[O-].C=Cc1ccccc1C=C.[K+] |
| UNII-0BZ5A00FQU |
| 2-Propenoic acid,2-methyl-,potassium salt (1:1),polymer with diethenylbenzene |
| 2-Propenoic acid,2-methyl-,potassium salt,polymer with diethenylbenzene |
| Divinylbenzene,potassium methacrylate polymer |