5-chloro-2-(trifluoromethyl)benzamide
Modify Date: 2025-08-25 12:17:58
5-chloro-2-(trifluoromethyl)benzamide structure
|
Common Name | 5-chloro-2-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 654-94-4 | Molecular Weight | 223.58000 | |
| Density | 1.455g/cm3 | Boiling Point | 241.9ºC at 760 mmHg | |
| Molecular Formula | C8H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.1ºC | |
| Name | 5-chloro-2-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 241.9ºC at 760 mmHg |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.58000 |
| Flash Point | 100.1ºC |
| Exact Mass | 223.00100 |
| PSA | 43.09000 |
| LogP | 3.15800 |
| Index of Refraction | 1.498 |
| InChIKey | GHXSHBPNICIQJS-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(Cl)ccc1C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chlor-2-trifluormethyl-benzamid |