(8E)-8-benzylidene-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione structure
|
Common Name | (8E)-8-benzylidene-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione | ||
|---|---|---|---|---|
| CAS Number | 65331-27-3 | Molecular Weight | 332.46200 | |
| Density | 1.24g/cm3 | Boiling Point | 516.5ºC at 760 mmHg | |
| Molecular Formula | C21H20N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
| Name | (8E)-8-benzylidene-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 516.5ºC at 760 mmHg |
| Molecular Formula | C21H20N2S |
| Molecular Weight | 332.46200 |
| Flash Point | 266.1ºC |
| Exact Mass | 332.13500 |
| PSA | 56.15000 |
| LogP | 5.38460 |
| Index of Refraction | 1.694 |
| InChIKey | OIWFTKSWHDPJCN-SAPNQHFASA-N |
| SMILES | S=C1NC2=C(CCCC2=Cc2ccccc2)C(c2ccccc2)N1 |
|
~95%
(8E)-8-benzylid... CAS#:65331-27-3 |
| Literature: Ghashang, Majid; Mansoor, Syed Sheik; Aswin, Krishnamoorthy Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 11 p. 3289 - 3294 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-benzylidene-4-phenyl-3,4,5,6,7,8-hexahydro-1H-quinazolin-2-thione |
| HMS2548P24 |
| 8-benzylidene-4-phenyl-3,4,5,6,7,8-hexahydro-1H-quinazoline-2-thione |