1-triethylstannylpyrrole-2,5-dione structure
|
Common Name | 1-triethylstannylpyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 65284-41-5 | Molecular Weight | 301.94800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-triethylstannylpyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17NO2Sn |
|---|---|
| Molecular Weight | 301.94800 |
| Exact Mass | 303.02800 |
| PSA | 52.49000 |
| LogP | 1.48780 |
| InChIKey | VTMRVFBBLOYPKG-UHFFFAOYSA-M |
| SMILES | CC[Sn](CC)(CC)N1C(=O)C=CC1=O |
|
~90%
1-triethylstann... CAS#:65284-41-5 |
| Literature: Razuvaev, G. A.; Shcherbakov, V. I.; Stolyarova, N. E. Synthesis and Reactivity in Inorganic and Metal-Organic Chemistry, 1983 , vol. 13, p. 59 - 66 |
| 1H-Pyrrole-2,5-dione,1-(triethylstannyl) |
| N-(triethylstannyl)maleimide |