1-[4-(Phenylsulfonyl)phenyl]ethanone structure
|
Common Name | 1-[4-(Phenylsulfonyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 65085-83-8 | Molecular Weight | 260.308 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 450.7±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O3S | Melting Point | 138-140°C | |
| MSDS | USA | Flash Point | 284.6±16.7 °C | |
| Name | 4-acetyldiphenyl sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.7±28.0 °C at 760 mmHg |
| Melting Point | 138-140°C |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.308 |
| Flash Point | 284.6±16.7 °C |
| Exact Mass | 260.050720 |
| PSA | 59.59000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | FGFHDNIGKVTTLC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(S(=O)(=O)c2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed . |
| Safety Phrases | S22-S36/37/39 |
| RIDADR | 2811 |
| RTECS | CY6920000 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| p-acetophenyl phenyl sulfone |
| MFCD00173085 |
| 1-[4-(phenylsulfonyl)phenyl]ethan-1-one |
| Ethanone, 1-[4-(phenylsulfonyl)phenyl]- |
| 4'-benzenesulfonylacetophenone |
| 1-(4-(benzenesulfonyl)phenyl)ethanone |
| 4-ACETYLDIPHENYL SUL |
| 1-[4-(PHENYLSULFONYL)PHENYL]-1-ETHANONE |
| 1-(4-(phenylsulfonyl)phenyl)ethanone |
| 4-Acetyldiphenylsulphone |
| ETHANONE,1-[4-(PHENYLSULFONYL)PHENYL] |
| 1-[4-(phenylsulphonyl)phenyl]ethan-1-one |
| 4'-(phenylsulfonyl)acetophenone |
| 1-[4-(Phenylsulfonyl)phenyl]ethanone |