4H-1-Benzopyran-4-one, 2-(diethylamino)- structure
|
Common Name | 4H-1-Benzopyran-4-one, 2-(diethylamino)- | ||
|---|---|---|---|---|
| CAS Number | 64965-01-1 | Molecular Weight | 217.26400 | |
| Density | 1.14g/cm3 | Boiling Point | 309.2ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | 2-(diethylamino)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 309.2ºC at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 140.8ºC |
| Exact Mass | 217.11000 |
| PSA | 33.45000 |
| LogP | 2.63920 |
| Index of Refraction | 1.576 |
| InChIKey | YROQGDCTFDQWPP-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc(=O)c2ccccc2o1 |
| HS Code | 2922399090 |
|---|
|
~83%
4H-1-Benzopyran... CAS#:64965-01-1 |
| Literature: Roma, Giorgio; Piras, Daniela; Di Braccio, Mario; Grossi, Giancarlo Synthesis, 2010 , # 5 art. no. Z22309SS, p. 849 - 857 |
|
~%
4H-1-Benzopyran... CAS#:64965-01-1 |
| Literature: Kaye, Perry T.; Ramaite, Isaiah D.I. South African Journal of Chemistry, 2003 , vol. 56, p. 25 - 29 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Dietilamminocromone |
| 2-diethylamino-chromen-4-one |
| 2-(Diethylamino)-4H-1-benzopyran-4-one |
| 2-Dietilamminocromone [Italian] |
| 4H-1-Benzopyran-4-one,2-(diethylamino) |