2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)disulfanyl]phenol structure
|
Common Name | 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)disulfanyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 64953-47-5 | Molecular Weight | 474.76200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H42O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)disulfanyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H42O2S2 |
|---|---|
| Molecular Weight | 474.76200 |
| Exact Mass | 474.26300 |
| PSA | 91.06000 |
| LogP | 9.08720 |
| InChIKey | OQNMSUCZVWYXHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(SSc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
|
~32%
2,4-ditert-buty... CAS#:64953-47-5 |
| Literature: Kanti Paine, Tapan; Sheet, Debobrata; Weyhermueller, Thomas; Chaudhuri, Phalguni European Journal of Inorganic Chemistry, 2011 , # 34 p. 5250 - 5257 |
|
~65%
2,4-ditert-buty... CAS#:64953-47-5 |
| Literature: Pastor, Stephen D.; Denney, Dorothy Z. Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 2 p. 681 - 683 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenol,2,2'-dithiobis[4,6-bis(1,1-dimethylethyl) |
| 2,2'-dithiobis(4,6-di-t-butylphenol) |
| 2,2'-dithiobis(4,6-di-tert-butylphenol) |