4-Amino-1,8-naphthalic anhydride structure
|
Common Name | 4-Amino-1,8-naphthalic anhydride | ||
|---|---|---|---|---|
| CAS Number | 6492-86-0 | Molecular Weight | 213.18900 | |
| Density | 1.105 g/mL at 25 °C(lit.) | Boiling Point | 501.4ºC at 760 mmHg | |
| Molecular Formula | C12H7NO3 | Melting Point | 360 °C | |
| MSDS | Chinese USA | Flash Point | 310.8ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 4-Amino-1,8-naphthalic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 501.4ºC at 760 mmHg |
| Melting Point | 360 °C |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.18900 |
| Flash Point | 310.8ºC |
| Exact Mass | 213.04300 |
| PSA | 69.39000 |
| LogP | 2.31380 |
| Index of Refraction | 1.77 |
| InChIKey | QIXHMCMCFSNKOG-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c3c(cccc13)C(=O)OC2=O |
| Storage condition | −20°C |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335-H350 |
| Precautionary Statements | P201-P261-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 45-20/21/22-36/37/38 |
| Safety Phrases | S53-S22-S26-S36/37/39-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DE4081000 |
| HS Code | 2932999099 |
|
~97%
4-Amino-1,8-nap... CAS#:6492-86-0 |
| Literature: Cheon, Kap-Soo; Kazmaier, Peter M.; Keum, Sam-Rok; Park, Kuk-Tae; Buncel, Erwin Canadian Journal of Chemistry, 2004 , vol. 82, # 4 p. 551 - 566 |
|
~%
4-Amino-1,8-nap... CAS#:6492-86-0 |
| Literature: US6177423 B1, ; |
|
~%
4-Amino-1,8-nap... CAS#:6492-86-0 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 41, # 6 p. 1238 - 1245 |
|
~%
4-Amino-1,8-nap... CAS#:6492-86-0 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 41, # 6 p. 1238 - 1245 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Aminobenzo[de]isochromene-1,3-dione |
| 4-aminonaphthalic anhydride |
| 6-amino-1h,3h-benzo[de]isochromene-1,3-dione |
| EINECS 229-372-4 |
| MFCD00006921 |
| 4-amino-1,8-naphthoic anhydride |
| 4-aminonaphthalic-1,8-anhydride |
| 4-amino-1,8-napthalic anhydride |