1-(4-methoxyphenyl)-2-(4-nitrophenyl)butan-1-one
Modify Date: 2025-11-25 12:02:27
1-(4-methoxyphenyl)-2-(4-nitrophenyl)butan-1-one structure
|
Common Name | 1-(4-methoxyphenyl)-2-(4-nitrophenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 64780-22-9 | Molecular Weight | 299.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-2-(4-nitrophenyl)butan-1-one |
|---|
| Molecular Formula | C17H17NO4 |
|---|---|
| Molecular Weight | 299.32100 |
| Exact Mass | 299.11600 |
| PSA | 72.12000 |
| LogP | 4.50310 |
| InChIKey | ZIGNKABLFIYARZ-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)c1ccc(OC)cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
1-(4-methoxyphe... CAS#:64780-22-9 |
| Literature: Rubin; Wishinsky Journal of the American Chemical Society, 1944 , vol. 66, p. 1948 |
|
~%
1-(4-methoxyphe... CAS#:64780-22-9 |
| Literature: Rubin; Wishinsky Journal of the American Chemical Society, 1944 , vol. 66, p. 1948 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |