6,6-dimethyl-3,4-bis(phenylsulfanyl)hepta-2,4-dienal structure
|
Common Name | 6,6-dimethyl-3,4-bis(phenylsulfanyl)hepta-2,4-dienal | ||
|---|---|---|---|---|
| CAS Number | 647010-36-4 | Molecular Weight | 354.52900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,6-dimethyl-3,4-bis(phenylsulfanyl)hepta-2,4-dienal |
|---|
| Molecular Formula | C21H22OS2 |
|---|---|
| Molecular Weight | 354.52900 |
| Exact Mass | 354.11100 |
| PSA | 67.67000 |
| LogP | 6.58380 |
| InChIKey | GNYYLRSVDPTURC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C=C(Sc1ccccc1)C(=CC=O)Sc1ccccc1 |
|
~72%
6,6-dimethyl-3,... CAS#:647010-36-4 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
|
~%
6,6-dimethyl-3,... CAS#:647010-36-4 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
|
~%
6,6-dimethyl-3,... CAS#:647010-36-4 |
| Literature: Yoshimatsu, Mitsuhiro; Matsuura, Yasutaka; Gotoh, Kohei Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 12 p. 1405 - 1412 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |