Anthraquinone-2-carbonyl Chloride structure
|
Common Name | Anthraquinone-2-carbonyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 6470-87-7 | Molecular Weight | 270.667 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 463.9±34.0 °C at 760 mmHg | |
| Molecular Formula | C15H7ClO3 | Melting Point | 147ºC | |
| MSDS | N/A | Flash Point | 195.1±26.2 °C | |
| Name | Anthraquinone-2-carbonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.9±34.0 °C at 760 mmHg |
| Melting Point | 147ºC |
| Molecular Formula | C15H7ClO3 |
| Molecular Weight | 270.667 |
| Flash Point | 195.1±26.2 °C |
| Exact Mass | 270.008362 |
| PSA | 51.21000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | DGJNWQJOASAMHY-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| Hazard Codes | C |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3261 |
| Packaging Group | III |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9,10-Dioxo-9,10-dihydro-2-anthracenecarbonyl chloride |
| 2-Anthracenecarbonyl chloride, 9,10-dihydro-9,10-dioxo- |
| 9,10-Dioxo-9,10-dihydroanthracene-2-carbonyl chloride |
| 9,10-dioxoanthracene-2-carbonyl chloride |