2-methyl-1-(2-phenylmethoxyphenyl)propan-1-one structure
|
Common Name | 2-methyl-1-(2-phenylmethoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 64686-76-6 | Molecular Weight | 254.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-1-(2-phenylmethoxyphenyl)propan-1-one |
|---|
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32400 |
| Exact Mass | 254.13100 |
| PSA | 26.30000 |
| LogP | 4.10430 |
| InChIKey | MDELTTSQKNXQPG-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)c1ccccc1OCc1ccccc1 |
|
~%
2-methyl-1-(2-p... CAS#:64686-76-6 |
| Literature: Matsuda, Takanori; Shigeno, Masanori; Murakami, Masahiro Journal of the American Chemical Society, 2007 , vol. 129, # 40 p. 12086 - 12087 |
|
~57%
2-methyl-1-(2-p... CAS#:64686-76-6 |
| Literature: Sharshira, Essam Mohamed; Horaguchi, Takaaki Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 6 p. 1837 - 1848 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |