2-methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one structure
|
Common Name | 2-methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 778-40-5 | Molecular Weight | 204.30800 | |
| Density | 0.93g/cm3 | Boiling Point | 308.7ºC at 760 mmHg | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.2ºC | |
| Name | 2-methyl-1-(2,3,5,6-tetramethylphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 308.7ºC at 760 mmHg |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.30800 |
| Flash Point | 128.2ºC |
| Exact Mass | 204.15100 |
| PSA | 17.07000 |
| LogP | 3.75890 |
| Index of Refraction | 1.502 |
| InChIKey | YKRDIDRSBAFSHF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C)c(C(=O)C(C)C)c1C |
|
~%
2-methyl-1-(2,3... CAS#:778-40-5 |
| Literature: Dhami,K.S.; Stothers,J.B. Canadian Journal of Chemistry, 1965 , vol. 43, p. 498 - 509 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Isopropyl duryl ketone |
| 2,3,5,6-tetramethyl-isobutyrophenone |
| Propiophenone,2,2',3',5',6'-pentamethyl |