1,4-Naphthalenedione,2-chloro-3-[(2-methylphenyl)amino]-
Modify Date: 2025-08-25 16:27:27
![1,4-Naphthalenedione,2-chloro-3-[(2-methylphenyl)amino]- Structure](https://image.chemsrc.com/caspic/110/64530-59-2.png)
1,4-Naphthalenedione,2-chloro-3-[(2-methylphenyl)amino]- structure
|
Common Name | 1,4-Naphthalenedione,2-chloro-3-[(2-methylphenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 64530-59-2 | Molecular Weight | 297.73600 | |
| Density | 1.36g/cm3 | Boiling Point | 415.1ºC at 760mmHg | |
| Molecular Formula | C17H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 2-chloro-3-(2-methylanilino)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 415.1ºC at 760mmHg |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.73600 |
| Flash Point | 204.8ºC |
| Exact Mass | 297.05600 |
| PSA | 46.17000 |
| LogP | 4.00950 |
| Index of Refraction | 1.659 |
| InChIKey | YAYFVDVCXXGDPM-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC1=C(Cl)C(=O)c2ccccc2C1=O |
| HS Code | 2922399090 |
|---|
|
~94%
1,4-Naphthalene... CAS#:64530-59-2 |
| Literature: Benites, Julio; Valderrama, Jaime A.; Bettega, Karina; Pedrosa, Rozangela Curi; Calderon, Pedro Buc; Verrax, Julien European Journal of Medicinal Chemistry, 2010 , vol. 45, # 12 p. 6052 - 6057 |
|
~%
1,4-Naphthalene... CAS#:64530-59-2 |
| Literature: Plagemann Chemische Berichte, 1882 , vol. 15, p. 485 Anm. 1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-chloro-3-[(2-methylphenyl)amino]naphthalene-1,4-dione |