6-ethoxy-4-nitro-1H-benzimidazole
Modify Date: 2025-08-26 22:01:10
6-ethoxy-4-nitro-1H-benzimidazole structure
|
Common Name | 6-ethoxy-4-nitro-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 64457-67-6 | Molecular Weight | 207.18600 | |
| Density | 1.405g/cm3 | Boiling Point | 500.8ºC at 760mmHg | |
| Molecular Formula | C9H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.6ºC | |
| Name | 6-ethoxy-4-nitro-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 500.8ºC at 760mmHg |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.18600 |
| Flash Point | 256.6ºC |
| Exact Mass | 207.06400 |
| PSA | 83.73000 |
| LogP | 2.39300 |
| Index of Refraction | 1.66 |
| InChIKey | XWDNXEPBKMMVIH-UHFFFAOYSA-N |
| SMILES | CCOc1cc([N+](=O)[O-])c2nc[nH]c2c1 |
|
~%
6-ethoxy-4-nitr... CAS#:64457-67-6 |
| Literature: Gillespie et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 2245,2247 |
|
~%
6-ethoxy-4-nitr... CAS#:64457-67-6 |
| Literature: Gillespie et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 2245,2247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H-Benzimidazole,6-ethoxy-4-nitro |