(+/-)-1-methoxy-1-(trifluoromethyl)phenylacetyl chloride
Modify Date: 2025-08-21 18:57:32
(+/-)-1-methoxy-1-(trifluoromethyl)phenylacetyl chloride structure
|
Common Name | (+/-)-1-methoxy-1-(trifluoromethyl)phenylacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 64312-89-6 | Molecular Weight | 255.64100 | |
| Density | 1.327 g/mL at 25 °C(lit.) | Boiling Point | 213-214 °C(lit.) | |
| Molecular Formula | C10H11ClF3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 190 °F | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 213-214 °C(lit.) |
| Molecular Formula | C10H11ClF3O2 |
| Molecular Weight | 255.64100 |
| Flash Point | 190 °F |
| Exact Mass | 255.04000 |
| PSA | 26.30000 |
| LogP | 3.30380 |
| Index of Refraction | n20/D 1.471(lit.) |
| InChIKey | PAORVUMOXXAMPL-UHFFFAOYSA-N |
| SMILES | COC(C(=O)Cl)(c1ccccc1)C(F)(F)F |
| Storage condition | Keep Cold |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | 34-43 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
|
~%
(+/-)-1-methoxy... CAS#:64312-89-6 |
| Literature: Tetrahedron Letters, , vol. 30, # 14 p. 1749 - 1752 |
|
~%
(+/-)-1-methoxy... CAS#:64312-89-6 |
| Literature: Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, , vol. 36, # 8 p. 499 - 504 |
|
~%
(+/-)-1-methoxy... CAS#:64312-89-6 |
| Literature: Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, , vol. 36, # 8 p. 499 - 504 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Mosher's acid chloride |
| Mosher reagent |
| MFCD00078209 |