Phe-Arg-Arg-Gly
Modify Date: 2025-09-21 13:31:05
Phe-Arg-Arg-Gly structure
|
Common Name | Phe-Arg-Arg-Gly | ||
|---|---|---|---|---|
| CAS Number | 642080-61-3 | Molecular Weight | 534.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H38N10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Phe-Arg-Arg-GlyPhe-Arg-Arg-Gly is a polypeptide that can be used for agent coupling[1]. |
| Name | Phe-Arg-Arg-Gly |
|---|
| Description | Phe-Arg-Arg-Gly is a polypeptide that can be used for agent coupling[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H38N10O5 |
|---|---|
| Molecular Weight | 534.61 |
| InChIKey | RNZLMFKPAJWWPY-ULQDDVLXSA-N |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O |