(4-nitrophenyl)-(4-pyrrolidin-1-ylphenyl)diazene
Modify Date: 2025-08-27 16:05:18
(4-nitrophenyl)-(4-pyrrolidin-1-ylphenyl)diazene structure
|
Common Name | (4-nitrophenyl)-(4-pyrrolidin-1-ylphenyl)diazene | ||
|---|---|---|---|---|
| CAS Number | 64193-73-3 | Molecular Weight | 296.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl)-(4-pyrrolidin-1-ylphenyl)diazene |
|---|
| Molecular Formula | C16H16N4O2 |
|---|---|
| Molecular Weight | 296.32400 |
| Exact Mass | 296.12700 |
| PSA | 73.78000 |
| LogP | 5.19860 |
| InChIKey | VGMSYXYRBCIRJT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(N3CCCC3)cc2)cc1 |
|
~%
(4-nitrophenyl)... CAS#:64193-73-3 |
| Literature: Hallas, Geoffrey; Marsden, Richard; Hepworth, John D.; Mason, Donald Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 149 - 154 |
|
~%
(4-nitrophenyl)... CAS#:64193-73-3 |
| Literature: Hallas, Geoffrey; Marsden, Richard; Hepworth, John D.; Mason, Donald Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 149 - 154 |
