4-N-CBZ-2-piperazine carboxylic acid structure
|
Common Name | 4-N-CBZ-2-piperazine carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 64172-98-1 | Molecular Weight | 264.277 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 465.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1±28.7 °C | |
| Name | 4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.1±45.0 °C at 760 mmHg |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.277 |
| Flash Point | 235.1±28.7 °C |
| Exact Mass | 264.110992 |
| PSA | 78.87000 |
| LogP | 0.88 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | ARLOIFJEXPDJGV-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CN(C(=O)OCc2ccccc2)CCN1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Piperazinedicarboxylic acid, 1-(phenylmethyl) ester |
| 4-[(Benzyloxy)carbonyl]-2-piperazinecarboxylic acid |
| 4-carbobenzoxypiperazine-2-carboxylic acid |
| MFCD02179116 |
| 4-Cbz-2-piperazinecarboxylic acid |
| 4-N-CBZ-2-piperazine carboxylic acid |
| 4-N-CBZ-piperazine-2-carboxylic acid |
| N-4-Cbz-2-piperazinecarboxylic acid |
| 4-cbz-piperazine-2-carboxylic acid |
| 4-benzyloxycarbonyl-2-piperazinecarboxylic acid |
| 4-[(Benzyloxy)carbonyl]piperazine-2-carboxylic acid |
| 4-carbobenzyloxypiperazine-2-carboxylic acid |