2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)]-9H-purine structure
|
Common Name | 2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)]-9H-purine | ||
|---|---|---|---|---|
| CAS Number | 641571-44-0 | Molecular Weight | 628.03 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 816.3±75.0 °C at 760 mmHg | |
| Molecular Formula | C32H26ClN5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 447.5±37.1 °C | |
Use of 2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)]-9H-purine2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-Methyl-beta-D-ribofuranosyl)]-9H-purine dibenzoate is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-Methyl-beta-D-ribofuranosyl)]-9H-purine dibenzoate is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 816.3±75.0 °C at 760 mmHg |
| Molecular Formula | C32H26ClN5O7 |
| Molecular Weight | 628.03 |
| Flash Point | 447.5±37.1 °C |
| Exact Mass | 627.152100 |
| LogP | 7.85 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | HHGHJWFDGDHDSS-ZLZVUVTQSA-N |
| SMILES | CC1(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(COC(=O)c2ccccc2)OC1n1cnc2c(Cl)nc(N)nc21 |
| 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine |
| 9H-Purin-2-amine, 6-chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)- |