2,2'-methylenebis[6-cyclopentyl-p-cresol] structure
|
Common Name | 2,2'-methylenebis[6-cyclopentyl-p-cresol] | ||
|---|---|---|---|---|
| CAS Number | 64062-73-3 | Molecular Weight | 364.52000 | |
| Density | 1.12g/cm3 | Boiling Point | 448.3ºC at 760 mmHg | |
| Molecular Formula | C25H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.6ºC | |
| Name | 2-cyclopentyl-6-[(3-cyclopentyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 448.3ºC at 760 mmHg |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.52000 |
| Flash Point | 190.6ºC |
| Exact Mass | 364.24000 |
| PSA | 40.46000 |
| LogP | 6.62060 |
| Index of Refraction | 1.601 |
| InChIKey | IZJOSLLELCZERT-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)cc(C3CCCC3)c2O)c(O)c(C2CCCC2)c1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| einecs 264-647-2 |