2,3,4-trimethyl-3-phenylsulfanylpent-4-en-2-ol structure
|
Common Name | 2,3,4-trimethyl-3-phenylsulfanylpent-4-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 63996-57-6 | Molecular Weight | 236.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4-trimethyl-3-phenylsulfanylpent-4-en-2-ol |
|---|
| Molecular Formula | C14H20OS |
|---|---|
| Molecular Weight | 236.37300 |
| Exact Mass | 236.12300 |
| PSA | 45.53000 |
| LogP | 3.88440 |
| InChIKey | YCASRMKUWQAWTM-UHFFFAOYSA-N |
| SMILES | C=C(C)C(C)(Sc1ccccc1)C(C)(C)O |
|
~%
2,3,4-trimethyl... CAS#:63996-57-6 |
| Literature: Brownbridge,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1131 - 1141 |
|
~%
2,3,4-trimethyl... CAS#:63996-57-6 |
| Literature: Brownbridge,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1131 - 1141 |
|
~%
2,3,4-trimethyl... CAS#:63996-57-6 |
| Literature: Brownbridge,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1131 - 1141 |