4'-(1,4-Dihydro-2-mercapto-4,4,6-trimethylpyrimidin-1-yl)acetophenone structure
|
Common Name | 4'-(1,4-Dihydro-2-mercapto-4,4,6-trimethylpyrimidin-1-yl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 63990-68-1 | Molecular Weight | 274.38100 | |
| Density | 1.2g/cm3 | Boiling Point | 402.1ºC at 760mmHg | |
| Molecular Formula | C15H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197ºC | |
| Name | 1-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760mmHg |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.38100 |
| Flash Point | 197ºC |
| Exact Mass | 274.11400 |
| PSA | 71.47000 |
| LogP | 3.17800 |
| Index of Refraction | 1.625 |
| InChIKey | GWNDISICAKEBKR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N2C(=S)NC(C)(C)C=C2C)cc1 |
|
~%
4'-(1,4-Dihydro... CAS#:63990-68-1 |
| Literature: Mathes Journal of the American Chemical Society, 1953 , vol. 75, p. 1747 |
| usaf pd-66 |