diethyl-methyl-(4-methyl-2-oxochromen-7-yl)azanium,iodide
Modify Date: 2025-08-25 19:23:18
diethyl-methyl-(4-methyl-2-oxochromen-7-yl)azanium,iodide structure
|
Common Name | diethyl-methyl-(4-methyl-2-oxochromen-7-yl)azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 63977-62-8 | Molecular Weight | 373.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl-methyl-(4-methyl-2-oxochromen-7-yl)azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20INO2 |
|---|---|
| Molecular Weight | 373.22900 |
| Exact Mass | 373.05400 |
| PSA | 30.21000 |
| LogP | 0.08230 |
| InChIKey | IFXDPVZRMJLBPN-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)c1ccc2c(C)cc(=O)oc2c1.[I-] |
|
~%
diethyl-methyl-... CAS#:63977-62-8 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| Methiodide of 4-methyl-7-diethylaminocoumarin |