(2-Fluoro-5-nitrophenyl)methanol structure
|
Common Name | (2-Fluoro-5-nitrophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 63878-73-9 | Molecular Weight | 171.126 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 319.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H6FNO3 | Melting Point | 68-71ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 146.8±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2-Fluoro-5-nitrophenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.0±27.0 °C at 760 mmHg |
| Melting Point | 68-71ºC(lit.) |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.126 |
| Flash Point | 146.8±23.7 °C |
| Exact Mass | 171.033173 |
| PSA | 66.05000 |
| LogP | 0.62 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | IFIOUOYJVOSTFH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(F)c(CO)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2906299090 |
|
~99%
(2-Fluoro-5-nit... CAS#:63878-73-9 |
| Literature: Le Fur, Nicolas; Larchanche, Paul-Emmanuel; Melnyk, Patricia Heterocyclic Communications, 2010 , vol. 16, # 4-6 p. 235 - 239 |
|
~96%
(2-Fluoro-5-nit... CAS#:63878-73-9 |
| Literature: Chugai Seiyaku Kabushiki Kaisha Patent: US6534546 B1, 2003 ; |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Design, Synthesis and Evaluation of New Fluoroamodiaquine Analogues.
.PubMed ID Malaria is one of the most important tropical diseases; the use of amodiaquine as a current chemotherapy in the treatment of malaria has shown some problems such as hepatotoxicity and agranulocytosis.... |
|
|
4H-1-Benzopyrans by a tandem SN2-SNAr reaction. Bunce RA, et al.
J. Heterocycl. Chem. 45(2) , 547-550, (2008)
|
| (2-fluoro-5-nitrophenyl)methan-1-ol |
| MFCD02683502 |
| 2-Fluor-5-nitro-benzylalkohol |
| 2-fluoro-5-nitro-benzenemethanol |
| (2-fluoro-5-nitro-phenyl)-methanol |
| (2-Fluoro-5-nitrophenyl)methanol |
| 2-Fluoro-5-nitrobenzyl alcohol |
| Benzenemethanol, 2-fluoro-5-nitro- |