Ethyl 2,4,6-Triisopropylbenzoate structure
|
Common Name | Ethyl 2,4,6-Triisopropylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 63846-76-4 | Molecular Weight | 276.41400 | |
| Density | 0.94g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C18H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.8ºC | |
| Name | Ethyl 2,4,6-Triisopropylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.41400 |
| Flash Point | 137.8ºC |
| Exact Mass | 276.20900 |
| PSA | 26.30000 |
| LogP | 5.23350 |
| Index of Refraction | 1.49 |
| InChIKey | SNMLXTDVQDHSKS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD03788745 |
| ethyl 2,4,6-tri(propan-2-yl)benzoate |