1,2-BIS((2R,5R)-2,5-DIMETHYLPHOSPHOLANO& structure
|
Common Name | 1,2-BIS((2R,5R)-2,5-DIMETHYLPHOSPHOLANO& | ||
|---|---|---|---|---|
| CAS Number | 638132-66-8 | Molecular Weight | 322.36200 | |
| Density | N/A | Boiling Point | 484ºC at 760 mmHg | |
| Molecular Formula | C18H28OP2 | Melting Point | 116-122ºC | |
| MSDS | Chinese USA | Flash Point | 246.5ºC | |
| Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethyl-1λ5-phospholane 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 484ºC at 760 mmHg |
|---|---|
| Melting Point | 116-122ºC |
| Molecular Formula | C18H28OP2 |
| Molecular Weight | 322.36200 |
| Flash Point | 246.5ºC |
| Exact Mass | 322.16200 |
| PSA | 40.47000 |
| LogP | 4.92380 |
| InChIKey | ORZVYNTUPREFTI-KLHDSHLOSA-N |
| SMILES | CC1CCC(C)P1c1ccccc1P1(=O)C(C)CCC1C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~%
1,2-BIS((2R,5R)... CAS#:638132-66-8 |
| Literature: Boezio, Alessandro A.; Pytkowicz, Julien; Cote, Alexandre; Charette, Andre B. Journal of the American Chemical Society, 2003 , vol. 125, # 47 p. 14260 - 14261 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| R,R-Me-BozPhos |