1,4-diphenyl-2-(triethoxymethyl)benzene structure
|
Common Name | 1,4-diphenyl-2-(triethoxymethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 63766-87-0 | Molecular Weight | 376.48800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-diphenyl-2-(triethoxymethyl)benzene |
|---|
| Molecular Formula | C25H28O3 |
|---|---|
| Molecular Weight | 376.48800 |
| Exact Mass | 376.20400 |
| PSA | 27.69000 |
| LogP | 6.24040 |
| InChIKey | OESSLDXYYRUUSN-UHFFFAOYSA-N |
| SMILES | CCOC(OCC)(OCC)c1cc(-c2ccccc2)ccc1-c1ccccc1 |
|
~%
1,4-diphenyl-2-... CAS#:63766-87-0 |
| Literature: Halton,B. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 731 - 735 |
|
~%
1,4-diphenyl-2-... CAS#:63766-87-0 |
| Literature: Halton,B. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 731 - 735 |