4-Azido-1-hydroxy-2,2,6,6-tetramethylpiperidine structure
|
Common Name | 4-Azido-1-hydroxy-2,2,6,6-tetramethylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 63697-61-0 | Molecular Weight | 198.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-Azido-1-hydroxy-2,2,6,6-tetramethylpiperidineN3-TEMPO is a click chemistry reagent containing an azide group. Click chemistry has great potential for use in binding between nucleic acids, lipids, proteins, and other molecules, and has been used in many research fields because of its beneficial characteristics, including high yield, high specificity, and simplicity[1]. |
| Name | 4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy |
|---|---|
| Synonym | More Synonyms |
| Description | N3-TEMPO is a click chemistry reagent containing an azide group. Click chemistry has great potential for use in binding between nucleic acids, lipids, proteins, and other molecules, and has been used in many research fields because of its beneficial characteristics, including high yield, high specificity, and simplicity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C9H18N4O |
|---|---|
| Molecular Weight | 198.26500 |
| Exact Mass | 198.14800 |
| PSA | 73.22000 |
| LogP | 2.09816 |
| InChIKey | HFUMVJSTAKNMEX-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(N=[N+]=[N-])CC(C)(C)N1[O] |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 4-azido-1-hydroxy-2,2,6,6-tetramethylpiperidine |