4,5-diamino-1-naphthalenesulfonic acid structure
|
Common Name | 4,5-diamino-1-naphthalenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6362-18-1 | Molecular Weight | 238.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-diaminonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2O3S |
|---|---|
| Molecular Weight | 238.26300 |
| Exact Mass | 238.04100 |
| PSA | 114.79000 |
| LogP | 3.49410 |
| InChIKey | DKIDDWUQCDKOEN-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c(S(=O)(=O)O)ccc(N)c12 |
| HS Code | 2921590090 |
|---|
|
~%
4,5-diamino-1-n... CAS#:6362-18-1 |
| Literature: Bucherer; Barsch Journal fuer Praktische Chemie (Leipzig), 1925 , vol. <2> 111, p. 317,325 |
|
~%
4,5-diamino-1-n... CAS#:6362-18-1 |
| Literature: Bucherer; Barsch Journal fuer Praktische Chemie (Leipzig), 1925 , vol. <2> 111, p. 317,325 |
|
~%
4,5-diamino-1-n... CAS#:6362-18-1 |
| Literature: Cassella and Co. Patent: DE70019 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 454 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,5-DIAMINO-1-NAPHTHALENESULFONIC ACID |
| 4,5-Diamino-naphthalinsulfonsaeure-(1) |
| BB_SC-3166 |
| 4,5-diamino-naphthalene-1-sulfonic acid |
| 4,5-Diamino-naphthalin-1-sulfonsaeure |
| Naphthylendiamin-(1.8)-sulfonsaeure-(4) |