Terfenadine N-Oxide structure
|
Common Name | Terfenadine N-Oxide | ||
|---|---|---|---|---|
| CAS Number | 634901-83-0 | Molecular Weight | 487.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H41NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Terfenadine N-Oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H41NO3 |
|---|---|
| Molecular Weight | 487.67 |
| Appearance of Characters | neat |
| InChIKey | CFDFVVYPNXXEDN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(O)CCC[N+]2([O-])CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| α-[4-(1,1-Dimethylethyl)phenyl]-4-(hydroxydiphenylmethyl)-1-piperidinebutanol 1-Oxide |