Acetic acid,2-[(4-acetylphenyl)amino]-2-oxo-, ethyl ester structure
|
Common Name | Acetic acid,2-[(4-acetylphenyl)amino]-2-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6345-12-6 | Molecular Weight | 235.23600 | |
| Density | 1.234g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(4-acetylanilino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Exact Mass | 235.08400 |
| PSA | 72.47000 |
| LogP | 1.46380 |
| Index of Refraction | 1.559 |
| InChIKey | ODVOHBDIDNNISL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1ccc(C(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Acetic acid,2-[... CAS#:6345-12-6 |
| Literature: Petyunin,P.A.; Kalugina,Z.G. J. Gen. Chem. USSR (Engl. Transl.), 1963 , vol. 33, # 9 p. 2835 - 2842,2762 - 2768 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-<4-acetyl-phenyl>-oxamidsaeure-aethylester |