3,3',5-trichlorobenzidine
Modify Date: 2025-08-25 11:48:34
3,3',5-trichlorobenzidine structure
|
Common Name | 3,3',5-trichlorobenzidine | ||
|---|---|---|---|---|
| CAS Number | 63390-12-5 | Molecular Weight | 287.57200 | |
| Density | 1.473g/cm3 | Boiling Point | 397.1ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 4-(4-amino-3-chlorophenyl)-2,6-dichloroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 397.1ºC at 760 mmHg |
| Molecular Formula | C12H9Cl3N2 |
| Molecular Weight | 287.57200 |
| Flash Point | 194ºC |
| Exact Mass | 285.98300 |
| PSA | 52.04000 |
| LogP | 5.64060 |
| Index of Refraction | 1.683 |
| InChIKey | FOHQHSMQKDVWSW-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2cc(Cl)c(N)c(Cl)c2)cc1Cl |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3',5-Trichloro-(1,1'-biphenyl)-4,4'-diamine |
| 3,5,3'-Trichlorobenzidine |
| 3,3',5-Trichlorbenzidin |
| 3,3',5-Trichlorobenzidine |
| Benzidine,3,3',5-trichloro |