3,3',5-PCB structure
|
Common Name | 3,3',5-PCB | ||
|---|---|---|---|---|
| CAS Number | 12674-11-2 | Molecular Weight | 257.543 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 354.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H7Cl3 | Melting Point | 63.91°C (estimate) | |
| MSDS | Chinese USA | Flash Point | 245.7±19.3 °C | |
| Symbol |
GHS02, GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 3,3',5-PCB |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.5±27.0 °C at 760 mmHg |
| Melting Point | 63.91°C (estimate) |
| Molecular Formula | C12H7Cl3 |
| Molecular Weight | 257.543 |
| Flash Point | 245.7±19.3 °C |
| Exact Mass | 255.961334 |
| LogP | 5.69 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | RIBGNAJQTOXRDK-UHFFFAOYSA-N |
| SMILES | Clc1cccc(-c2cc(Cl)cc(Cl)c2)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370-H373-H410 |
| Precautionary Statements | P210-P260-P273-P280-P301 + P310 + P330-P370 + P378 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N,T,Xi |
| Risk Phrases | 11-38-48/20-51/53-62-65-67-39/23/24/25-23/24/25-36/37/38-50/53-33-45 |
| Safety Phrases | 36/37-61-62-45-26-60-35-53-16 |
| RIDADR | 2315 |
| RTECS | TQ1351000 |
| Packaging Group | II |
|
Acute exposure to aroclor 1016 or 1260 differentially affects dopamine transporter and vesicular monoamine transporter 2 levels.
Toxicol. Lett. 148(1-2) , 29-40, (2004) Polychlorinated biphenyls (PCBs) have been shown to specifically target the dopaminergic nervous system, resulting in long-term reduction of striatal dopamine (DA) levels. However, the mechanism(s) by... |
|
|
Selective induction and inhibition of liver and lung cytochrome P-450-dependent monooxygenases by the PCBs mixture, Aroclor 1016.
Toxicology 35(2) , 83-94, (1985) The effects of the widely used industrial PCBs mixture, Aroclor 1016, as modifiers of monooxygenases were studied in rats and rabbits. From data presented, it is not possible to generalize the biologi... |
|
|
The effects of polychlorinated biphenyls (Aroclors 1016 and 1254) on mortality, reproduction, and regeneration in Hydra oligactis.
Arch. Environ. Contam. Toxicol. 13(4) , 493-9, (1984)
|
| 3,3',5-PCB |
| 1,1'-Biphenyl, 3,3',5-trichloro- |
| 3,3',5-Trichloro-1,1'-biphenyl |
| 3,3',5-Trichlorobiphenyl |
| Aroclor 1016 |