3-(2-nitrophenoxy)propanoic acid structure
|
Common Name | 3-(2-nitrophenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6336-59-0 | Molecular Weight | 211.17100 | |
| Density | 1.38g/cm3 | Boiling Point | 373.7ºC at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | 3-(2-nitrophenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 373.7ºC at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Flash Point | 179.8ºC |
| Exact Mass | 211.04800 |
| PSA | 92.35000 |
| LogP | 1.97150 |
| Index of Refraction | 1.571 |
| InChIKey | AKIYJDFJPJUROC-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOc1ccccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
3-(2-nitropheno... CAS#:6336-59-0 |
| Literature: ONO PHARMACEUTICAL CO., LTD. Patent: EP1475368 A1, 2004 ; Location in patent: Page 104 ; |
|
~38%
3-(2-nitropheno... CAS#:6336-59-0 |
| Literature: Imaki, Katsuhiro; Okada, Takanori; Nakayama, Yoshisuke; Nagao, Yuuki; Kobayashi, Kaoru; Sakai, Yasuhiro; Mohri, Tetsuya; Amino, Takaaki; Nakai, Hisao; Kawamura, Masanori Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 12 p. 2115 - 2134 |
|
~%
3-(2-nitropheno... CAS#:6336-59-0 |
| Literature: Chakravarti; Dutta Journal of the Indian Chemical Society, 1939 , vol. 16, p. 639,644 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(2-Nitro-phenoxy)-propionsaeure |
| 3-(2-nitrophenyloxy)propionic acid |
| 3-(2-NITROPHENOXY)PROPIONIC ACID |
| 3-(o-nitrophenoxy)propionic acid |