3-(2-carboxyethylsulfonylsulfanyl)propanoic acid
Modify Date: 2025-10-27 04:36:34
3-(2-carboxyethylsulfonylsulfanyl)propanoic acid structure
|
Common Name | 3-(2-carboxyethylsulfonylsulfanyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 18365-80-5 | Molecular Weight | 242.27000 | |
| Density | 1.595g/cm3 | Boiling Point | 586.3ºC at 760 mmHg | |
| Molecular Formula | C6H10O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.4ºC | |
| Name | 3-(2-carboxyethylsulfonylsulfanyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 586.3ºC at 760 mmHg |
| Molecular Formula | C6H10O6S2 |
| Molecular Weight | 242.27000 |
| Flash Point | 308.4ºC |
| Exact Mass | 241.99200 |
| PSA | 142.42000 |
| LogP | 1.07960 |
| Vapour Pressure | 2.89E-15mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | XVDZVKRQJUGRNX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCSS(=O)(=O)CCC(=O)O |
|
~%
3-(2-carboxyeth... CAS#:18365-80-5 |
| Literature: Vasil'eva, T. P.; Lin'kova, M. G.; Kil'disheva, O. V.; Knunyants, I. L. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1981 , vol. 30, # 1 p. 137 - 143 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1981 , # 1 p. 159 - 165 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| S-(3-Carboxyethyl)-3-thiosulfopropionsaeure |
| di(2-carboxyethyl)thiosulfonate |
| 3-{[(2-carboxyethyl)sulfanyl]sulfonyl}propanoic acid |